CAS 832-64-4

4-Methylphenanthrene

Description:

4-Methylphenanthrene is a polycyclic aromatic hydrocarbon (PAH) characterized by its fused aromatic rings and a methyl group substitution at the 4-position of the phenanthrene structure. It has a molecular formula of C15H12, indicating it consists of 15 carbon atoms and 12 hydrogen atoms. This compound typically appears as a solid at room temperature and is known for its hydrophobic nature, making it relatively insoluble in water but soluble in organic solvents. 4-Methylphenanthrene is of interest in environmental chemistry due to its presence in fossil fuels and its potential as a pollutant. It can be formed during the incomplete combustion of organic materials. Additionally, it has been studied for its biological activity, including potential mutagenic and carcinogenic properties, which are common among many PAHs. Its structural characteristics contribute to its stability and reactivity, making it a subject of research in various fields, including organic chemistry and environmental science. Safety precautions should be taken when handling this compound due to its toxicological implications.

Formula: C₁₅H₁₂

InChI: InChI=1/C15H12/c1-11-5-4-7-13-10-9-12-6-2-3-8-14(12)15(11)13/h2-10H,1H3

InChI key: InChIKey=LOCGAKKLRVLQAM-UHFFFAOYSA-N

SMILES: CC=1C2=C3C(=CC=C2C=CC1)C=CC=C3

Synonyms:

• Nsc 21046
• Phenanthrene, 4-methyl-
• Phenanthrene, 4-methyl- (8CI)(9CI)
• 4-Methylphenanthrene

4-Methylphenanthrene

Controlled Product

CAS: 832-64-4

Formula: C₁₅H₁₂

Color and Shape: Neat

Molecular weight: 192.256

Ref: TR-M329035