CymitQuimica logo

CAS 832-72-4

:

2,3,4,5,6-Pentafluorophenylacetyl chloride

Description:
2,3,4,5,6-Pentafluorophenylacetyl chloride is an organofluorine compound characterized by its highly fluorinated aromatic structure. It features a phenyl ring with five fluorine atoms substituted at the 2, 3, 4, 5, and 6 positions, which significantly enhances its reactivity and lipophilicity. The presence of the acetyl chloride functional group introduces a reactive acyl chloride moiety, making it useful in various chemical reactions, particularly in acylation processes. This compound is typically a colorless to pale yellow liquid and is known for its strong odor. Due to the electronegative fluorine atoms, it exhibits unique physical and chemical properties, such as increased stability against hydrolysis compared to non-fluorinated analogs. However, it is also highly reactive and can be hazardous, necessitating careful handling and storage. Its applications span across pharmaceuticals, agrochemicals, and materials science, where it serves as an intermediate in the synthesis of more complex fluorinated compounds. Safety precautions are essential due to its corrosive nature and potential environmental impact.
Formula:C8H2ClF5O
InChI:InChI=1/C8H2ClF5O/c9-3(15)1-2-4(10)6(12)8(14)7(13)5(2)11/h1H2
InChI key:InChIKey=UUHZXQCRVUYLII-UHFFFAOYSA-N
SMILES:C(C(Cl)=O)C1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:
  • (Pentafluorophenyl)Acetyl Chloride
  • 2,3,4,5,6-Pentafluorobenzeneacetyl chloride
  • 2,3,4,5,6-Pentafluorophenylacetyl chloride
  • 2-(Pentafluorophenyl)acetyl chloride
  • Acetyl chloride, (pentafluorophenyl)-
  • Benzeneacetyl chloride, 2,3,4,5,6-pentafluoro-
  • NSC 96896
  • (2,3,4,5,6-Pentafluorophenyl)acetyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.