CAS 83208-07-5
:5-Fluoro-α,α,2-trimethylbenzenemethanol
Description:
5-Fluoro-α,α,2-trimethylbenzenemethanol, with the CAS number 83208-07-5, is an organic compound characterized by its unique structure, which includes a fluorine atom and a hydroxymethyl group attached to a trimethyl-substituted benzene ring. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl group. The fluorine substitution can influence its chemical behavior, including its polarity and reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the presence of multiple methyl groups contributes to steric hindrance, which can affect its interactions with other molecules. As with many organic compounds, safety and handling precautions are essential, as it may pose health risks if ingested or inhaled. Overall, 5-Fluoro-α,α,2-trimethylbenzenemethanol is a compound of interest in synthetic organic chemistry and related fields.
Formula:C10H13FO
InChI:InChI=1S/C10H13FO/c1-7-4-5-8(11)6-9(7)10(2,3)12/h4-6,12H,1-3H3
InChI key:InChIKey=ZHZKYMLZVIUNKH-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C1=C(C)C=CC(F)=C1
Synonyms:- Benzenemethanol, 5-fluoro-α,α,2-trimethyl-
- 2-(3-Fluoro-6-methylphenyl)-2-propanol
- 5-Fluoro-α,α,2-trimethylbenzenemethanol
- 2-(5-Fluoro-2-methylphenyl)propan-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.