CymitQuimica logo

CAS 832090-44-5

:

methyl 4,6-dimethylpyrimidine-5-carboxylate

Description:
Methyl 4,6-dimethylpyrimidine-5-carboxylate is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features two methyl groups at the 4 and 6 positions of the pyrimidine ring, contributing to its overall hydrophobic character and influencing its reactivity and solubility. The carboxylate functional group at the 5 position, in conjunction with the methyl ester group, enhances its potential for various chemical reactions, including esterification and nucleophilic substitution. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c1-5-7(8(11)12-3)6(2)10-4-9-5/h4H,1-3H3
InChI key:XBSPXEYSNDFEIA-UHFFFAOYSA-N
SMILES:Cc1c(c(C)ncn1)C(=O)OC
Found 4 products.