CAS 832090-73-0

N-[(benzyloxy)carbonyl]-3-[(benzyloxy)(nitroso)amino]-L-alanine

Description:

N-[(benzyloxy)carbonyl]-3-[(benzyloxy)(nitroso)amino]-L-alanine is a synthetic amino acid derivative characterized by its complex structure, which includes a benzyloxycarbonyl group and a nitrosoamino group. This compound is typically used in biochemical research and may serve as a building block for peptide synthesis or as a probe in studies involving nitric oxide signaling due to the presence of the nitroso group. The benzyloxy groups enhance the compound's stability and solubility, making it suitable for various applications in organic synthesis and medicinal chemistry. Its molecular structure contributes to its potential reactivity and interactions with biological systems, particularly in the context of enzyme inhibition or modification of protein function. As with many synthetic compounds, safety and handling precautions are essential, as the nitroso group can be reactive and may pose health risks. Overall, this compound exemplifies the intricate design often found in synthetic organic chemistry aimed at exploring biological mechanisms.

Formula: C₁₈H₁₉N₃O₆

InChI: InChI=1/C18H19N3O6/c22-17(23)16(19-18(24)26-12-14-7-3-1-4-8-14)11-21(20-25)27-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,19,24)(H,22,23)/t16-/m0/s1

SMILES: c1ccc(cc1)COC(=N[C@@H](CN(N=O)OCc1ccccc1)C(=O)O)O

3-[Nitroso(benzyloxy)amino]-N-[(benzyloxy)carbonyl]-L-alanine

CAS: 832090-73-0

Molecular weight: 373.36

Ref: 7W-GM1389