CAS 832103-01-2
:5-amino-N,N-dimethyl-1-benzothiophene-2-carboxamide
Description:
5-amino-N,N-dimethyl-1-benzothiophene-2-carboxamide is a chemical compound characterized by its unique structure, which includes a benzothiophene core, an amine group, and a carboxamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. The dimethyl substitution on the nitrogen atom can affect its steric hindrance and electronic properties, potentially enhancing its biological activity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its specific CAS number, 832103-01-2, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data in chemical databases. Overall, 5-amino-N,N-dimethyl-1-benzothiophene-2-carboxamide represents a versatile compound with potential applications in various fields of research.
Formula:C11H12N2OS
InChI:InChI=1/C11H12N2OS/c1-13(2)11(14)10-6-7-5-8(12)3-4-9(7)15-10/h3-6H,12H2,1-2H3
SMILES:CN(C)C(=O)c1cc2cc(ccc2s1)N
Synonyms:- benzo[b]thiophene-2-carboxamide, 5-amino-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
