CAS 832113-96-9

Methyl 4-chloro-5-methylthieno[2,3-d]pyrimidine-6-carboxylate

Description:

Methyl 4-chloro-5-methylthieno[2,3-d]pyrimidine-6-carboxylate is a chemical compound characterized by its unique thieno-pyrimidine structure, which incorporates both a thieno ring and a pyrimidine ring. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of a chlorine atom at the 4-position and a methyl group at the 5-position of the pyrimidine ring influences its electronic properties and potential biological activity. It is typically used in medicinal chemistry and drug development due to its potential as a pharmacophore. The compound's molecular structure allows for various interactions with biological targets, making it of interest in the synthesis of novel therapeutic agents. Additionally, its stability and reactivity can be influenced by environmental conditions, such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling this substance, including the use of appropriate personal protective equipment.

Formula: C₉H₇ClN₂O₂S

InChI: InChI=1S/C9H7ClN2O2S/c1-4-5-7(10)11-3-12-8(5)15-6(4)9(13)14-2/h3H,1-2H3

SMILES: Cc1c2c(Cl)ncnc2sc1C(=O)OC

Thieno[2,​3-​d]​pyrimidine-​6-​carboxylic acid, 4-​chloro-​5-​methyl-​, methyl ester

CAS: 832113-96-9

Formula: C₉H₇ClN₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 242.6821

Ref: IN-DA00G5LV

Methyl 4-chloro-5-methyl-thieno[2,3-d]pyrimidine-6-carboxylate

CAS: 832113-96-9

Formula: C₉H₇ClN₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 242.68

Ref: 10-F021818