CAS 832114-04-2

4,4,5,5-tetramethyl-2-[2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane

Description:

4,4,5,5-Tetramethyl-2-[2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which includes a boron atom coordinated to two oxygen atoms and a carbon atom. This compound features a trifluoromethoxy group, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the tetramethyl substituents enhances its stability and solubility in organic solvents. The trifluoromethoxy group is known for its electron-withdrawing properties, which can influence the compound's reactivity and interaction with other chemical species. Additionally, the compound's boron atom can participate in various chemical reactions, such as cross-coupling reactions, making it valuable in synthetic organic chemistry. Overall, this compound's distinctive structure and functional groups make it a subject of interest for researchers exploring new chemical applications and methodologies.

Formula: C₁₃H₁₆BF₃O₃

InChI: InChI=1/C13H16BF3O3/c1-11(2)12(3,4)20-14(19-11)9-7-5-6-8-10(9)18-13(15,16)17/h5-8H,1-4H3

SMILES: CC1(C)C(C)(C)OB(c2ccccc2OC(F)(F)F)O1

Synonyms:

• 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[2-(trifluoromethoxy)phenyl]-
• 4,4,5,5-Tetramethyl-2-[2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane

2-Trifluoromethoxyphenylboronic acid, pinacol ester

CAS: 832114-04-2

Formula: C₁₃H₁₆BF₃O₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 288.0705

Ref: IN-DA003KD8

4,4,5,5-Tetramethyl-2-(2-trifluoromethoxyphenyl)-1,3,2-dioxaborolane

CAS: 832114-04-2

4,4,5,5-Tetramethyl-2-(2-trifluoromethoxyphenyl)-1,3,2-dioxaborolane

Purity: 98%

Molecular weight: 288.07g/mol

Ref: 54-PC412000

4,4,5,5-Tetramethyl-2-(2-trifluoromethoxyphenyl)-1,3,2-dioxaborolane

CAS: 832114-04-2

Formula: C₁₃H₁₆BF₃O₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 288.07

Ref: 10-F021843