CAS 83213-67-6

3-Azabicyclo[3.1.0]hexane, 1-(4-methylphenyl)-, (1S,5R)-

Description:

3-Azabicyclo[3.1.0]hexane, 1-(4-methylphenyl)-, (1S,5R)- is a bicyclic compound characterized by its unique structure, which includes a nitrogen atom incorporated into a bicyclic framework. This compound features a 4-methylphenyl group attached to the bicyclic core, contributing to its aromatic properties. The stereochemistry is specified as (1S,5R), indicating the spatial arrangement of atoms around the chiral centers, which can significantly influence the compound's biological activity and interactions. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the nitrogen atom in the bicyclic structure can enhance solubility and reactivity, while the aromatic substituent may provide additional stability and influence the compound's electronic properties. Overall, 3-Azabicyclo[3.1.0]hexane derivatives are studied for their potential applications in drug development and as intermediates in organic synthesis.

Formula: C₁₂H₁₅N

InChI: InChI=1S/C12H15N/c1-9-2-4-10(5-3-9)12-6-11(12)7-13-8-12/h2-5,11,13H,6-8H2,1H3/t11-,12+/m0/s1

InChI key: OFYVIGTWSQPCLF-NWDGAFQWSA-N

SMILES: CC1=CC=C(C=C1)[C@]23C[C@H]2CNC3