CymitQuimica logo

CAS 832138-80-4

:

ethyl 7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate

Description:
Ethyl 7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a trifluoromethyl group. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of the trifluoromethyl group, which can enhance its biological activity and influence its solubility in organic solvents. The ethyl ester functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and hydrolysis. Additionally, the presence of the pyrazolo and pyrimidine rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's stability, reactivity, and potential biological activity make it of interest in research and development, particularly in the fields of drug discovery and agrochemicals. As with many fluorinated compounds, it may also exhibit unique interactions with biological systems, warranting further investigation into its pharmacological properties.
Formula:C10H8F3N3O2
InChI:InChI=1/C10H8F3N3O2/c1-2-18-9(17)6-5-15-16-7(10(11,12)13)3-4-14-8(6)16/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1cnn2c(ccnc12)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.