CymitQuimica logo

CAS 83219-99-2

:

2-hydroxy-3-(2-hydroxy-3-oxo-1-phenylbutyl)-4H-chromen-4-one

Description:
2-Hydroxy-3-(2-hydroxy-3-oxo-1-phenylbutyl)-4H-chromen-4-one, also known by its CAS number 83219-99-2, is a synthetic organic compound belonging to the class of flavonoids. This compound features a chromone backbone, characterized by a benzopyran structure, which is a fused ring system consisting of a benzene ring and a pyran ring. The presence of hydroxyl groups contributes to its potential antioxidant properties, while the ketone functionality may enhance its reactivity and biological activity. This compound is often studied for its potential pharmacological effects, including anti-inflammatory and anticancer activities. Its complex structure suggests that it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, the presence of phenyl and hydroxy substituents can influence its solubility and stability, which are critical factors in drug development. Overall, 2-hydroxy-3-(2-hydroxy-3-oxo-1-phenylbutyl)-4H-chromen-4-one represents a fascinating area of research within the field of natural product chemistry and drug discovery.
Formula:C19H16O5
InChI:InChI=1/C19H16O5/c1-11(20)17(21)15(12-7-3-2-4-8-12)16-18(22)13-9-5-6-10-14(13)24-19(16)23/h2-10,15,17,21,23H,1H3
SMILES:CC(=O)C(C(c1ccccc1)c1c(=O)c2ccccc2oc1O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.