CymitQuimica logo

CAS 83235-86-3

:

hexopyranosyl-(1->6)hexopyranosyl-(1->6)-N-gamma-glutamylhexopyranosylamine

Description:
Hexopyranosyl-(1->6)hexopyranosyl-(1->6)-N-gamma-glutamylhexopyranosylamine, identified by the CAS number 83235-86-3, is a complex glycosylated compound featuring multiple hexopyranosyl units linked through (1->6) glycosidic bonds. This structure suggests that it is a polysaccharide derivative, likely exhibiting properties typical of glycoproteins or glycosaminoglycans. The presence of the N-gamma-glutamyl group indicates that it may have biological significance, potentially involved in cellular recognition or signaling processes. The compound's solubility, stability, and reactivity would depend on its specific molecular interactions and the functional groups present. Such compounds often exhibit a range of biological activities, including immunomodulatory effects or roles in cell adhesion. Additionally, the intricate structure may influence its physical properties, such as viscosity and gel formation, which are important in various applications, including pharmaceuticals and biotechnology. Further characterization through techniques like NMR or mass spectrometry would provide deeper insights into its properties and potential uses.
Formula:C23H40N2O18
InChI:InChI=1/C23H40N2O18/c24-6(21(37)38)1-2-10(27)25-20-17(34)14(31)12(29)8(41-20)4-39-23-19(36)16(33)13(30)9(43-23)5-40-22-18(35)15(32)11(28)7(3-26)42-22/h6-9,11-20,22-23,26,28-36H,1-5,24H2,(H,25,27)(H,37,38)
Synonyms:
  • glycotriosyl glutamine
  • Triglc-gln
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.