
CAS 83237-28-9
:5-[(Dimethylamino)methyl]-2-thiophenecarboxylic acid
Description:
5-[(Dimethylamino)methyl]-2-thiophenecarboxylic acid, with the CAS number 83237-28-9, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group (-COOH) and a dimethylamino group (-N(CH3)2) attached to the thiophene ring, contributing to its unique chemical properties. The presence of the dimethylamino group enhances its basicity and solubility in polar solvents, while the carboxylic acid group can participate in hydrogen bonding and acid-base reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with various biological targets, which could lead to applications in drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the thiophene ring. Overall, 5-[(Dimethylamino)methyl]-2-thiophenecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C8H11NO2S
InChI:InChI=1S/C8H11NO2S/c1-9(2)5-6-3-4-7(12-6)8(10)11/h3-4H,5H2,1-2H3,(H,10,11)
InChI key:InChIKey=MRIADWLEOQOBHL-UHFFFAOYSA-N
SMILES:C(N(C)C)C=1SC(C(O)=O)=CC1
Synonyms:- 5-[(Dimethylamino)methyl]-2-thiophenecarboxylic acid
- 2-Thiophenecarboxylic acid, 5-[(dimethylamino)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.