CymitQuimica logo

CAS 83244-81-9

:

2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxo-acetic acid

Description:
2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxo-acetic acid, with the CAS number 83244-81-9, is a chemical compound characterized by its unique structure that includes a thiadiazole ring and an amino acid moiety. This compound features a 5-methyl substituent on the thiadiazole, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of the carboxylic acid group (2-oxo-acetic acid) indicates that it can participate in various chemical reactions, including esterification and amidation. The thiadiazole ring is known for its role in various biological activities, making this compound of interest in medicinal chemistry. Its solubility and stability can vary depending on the pH and solvent conditions, which are important factors to consider in its application. Overall, this compound may exhibit properties that are useful in drug development, particularly in targeting specific biological pathways or as a scaffold for further chemical modifications.
Formula:C5H5N3O3S
InChI:InChI=1/C5H5N3O3S/c1-2-7-8-5(12-2)6-3(9)4(10)11/h1H3,(H,10,11)(H,6,8,9)
SMILES:Cc1n[nH]c(=NC(=O)C(=O)O)s1
Synonyms:
  • [(5-Methyl-1,3,4-Thiadiazol-2-Yl)Amino](Oxo)Acetic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.