CAS 83244-83-1

2-Oxo-2-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]acetic acid

Description:

2-Oxo-2-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]acetic acid, with the CAS number 83244-83-1, is a chemical compound characterized by its unique structure that includes a thiadiazole ring and an amino acid moiety. This compound features a 5-propyl substituent on the thiadiazole, which contributes to its biological activity and potential pharmacological properties. The presence of the oxo group and the carboxylic acid functionality suggests that it may exhibit acidic behavior and participate in various chemical reactions, including esterification and amide formation. Its thiadiazole component is known for its role in medicinal chemistry, often associated with antimicrobial and anti-inflammatory activities. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it of interest in both synthetic and medicinal chemistry. Overall, 2-Oxo-2-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]acetic acid represents a class of compounds that may have significant applications in drug development and agricultural chemistry.

Formula: C₇H₉N₃O₃S

InChI: InChI=1S/C7H9N3O3S/c1-2-3-4-9-10-7(14-4)8-5(11)6(12)13/h2-3H2,1H3,(H,12,13)(H,8,10,11)

InChI key: InChIKey=RFBJGOACSXXVNU-UHFFFAOYSA-N

SMILES: N(C(C(O)=O)=O)C=1SC(CCC)=NN1

Synonyms:

• Acetic acid, 2-oxo-2-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]-
• 2-Oxo-2-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]acetic acid
• Acetic acid, oxo[(5-propyl-1,3,4-thiadiazol-2-yl)amino]-
• Oxo[(5-propyl-1,3,4-thiadiazol-2-yl)amino]acetic acid