CymitQuimica logo

CAS 83244-85-3

:

2-[[5-(2-Methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetic acid

Description:
2-[[5-(2-Methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetic acid, with the CAS number 83244-85-3, is a chemical compound characterized by its unique structure that includes a thiadiazole ring and an amino acid derivative. This compound features a thiadiazole moiety, which contributes to its potential biological activity, particularly in agricultural and pharmaceutical applications. The presence of the 2-methylpropyl group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. The carboxylic acid functional group in the structure indicates that it can participate in acid-base reactions, making it a versatile compound in various chemical contexts. Additionally, the compound may exhibit specific interactions with biological targets, which could be of interest in drug design or agrochemical development. Overall, its unique structural features suggest potential utility in various fields, including medicinal chemistry and agricultural science, although specific biological activities and applications would require further investigation.
Formula:C8H11N3O3S
InChI:InChI=1S/C8H11N3O3S/c1-4(2)3-5-10-11-8(15-5)9-6(12)7(13)14/h4H,3H2,1-2H3,(H,13,14)(H,9,11,12)
InChI key:InChIKey=ZLESBFCTCSUMSO-UHFFFAOYSA-N
SMILES:N(C(C(O)=O)=O)C=1SC(CC(C)C)=NN1
Synonyms:
  • Acetic acid, 2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxo-
  • 2-[[5-(2-Methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetic acid
  • [[5-(2-Methylpropyl)-1,3,4-thiadiazol-2-yl]carbamoyl]formic acid
  • Acetic acid, [[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.