CAS 83248-83-3
:Neuraminic acid, N-acetyl-, homopolymer
Description:
Neuraminic acid, N-acetyl-, homopolymer, identified by CAS number 83248-83-3, is a polysaccharide derived from neuraminic acid, a nine-carbon sugar acid. This compound is characterized by its structure, which consists of repeating units of N-acetylneuraminic acid linked together through glycosidic bonds. It is known for its role in biological systems, particularly in cell recognition and signaling processes, as it is a component of glycoproteins and glycolipids found on cell surfaces. The homopolymer exhibits properties such as solubility in water, which can vary depending on the degree of polymerization and the presence of other functional groups. Its biological significance is underscored by its involvement in various physiological processes, including immune response and pathogen recognition. Additionally, neuraminic acid derivatives are studied for their potential applications in pharmaceuticals and biotechnology, particularly in vaccine development and as therapeutic agents. Overall, this compound is an important subject of research in biochemistry and molecular biology due to its functional roles in living organisms.
Formula:(C11H19NO9)x
InChI:InChI=1S/C11H19NO9/c1-4(14)12-8(5(15)2-6(16)11(20)21)10(19)9(18)7(17)3-13/h5,7-10,13,15,17-19H,2-3H2,1H3,(H,12,14)(H,20,21)/t5-,7+,8+,9+,10+/m0/s1
InChI key:InChIKey=KBGAYAKRZNYFFG-BOHATCBPSA-N
SMILES:[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)([C@H](CC(C(O)=O)=O)O)NC(C)=O
Synonyms:- N-Acetylneuraminic acid homopolymer
- D-glycero-D-galacto-2-Nonulosonic acid, 5-(acetylamino)-3,5-dideoxy-, homopolymer
- Neuraminic acid, N-acetyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
