CAS 83249-10-9
:1-Methyl bicyclo[1.1.1]pentane-1,3-dicarboxylate
Description:
1-Methyl bicyclo[1.1.1]pentane-1,3-dicarboxylate is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[1.1.1]pentane framework with two carboxylate ester groups at the 1 and 3 positions, along with a methyl group at the 1 position. This compound is typically colorless to pale yellow in appearance and is soluble in organic solvents due to the presence of the ester functional groups. Its molecular structure contributes to its unique chemical reactivity, making it a potential candidate for various synthetic applications in organic chemistry. The presence of the dicarboxylate moiety allows for potential interactions with nucleophiles, facilitating further chemical transformations. Additionally, the compound may exhibit interesting physical properties such as boiling and melting points that are influenced by its molecular weight and structure. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C8H10O4
InChI:InChI=1S/C8H10O4/c1-12-6(11)8-2-7(3-8,4-8)5(9)10/h2-4H2,1H3,(H,9,10)
InChI key:InChIKey=UJZHYIMESNWEQA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C12CC(C(O)=O)(C1)C2
Synonyms:- 1-Methyl bicyclo[1.1.1]pentane-1,3-dicarboxylate
- 3-(Methoxycarbonyl)Bicyclo[1.1.1]Pentane-1-Carboxylic Acid
- Bicyclo[1.1.1]pentane-1,3-dicarboxylic acid, 1-methyl ester
- Bicyclo[1.1.1]pentane-1,3-dicarboxylic acid, monomethyl ester
- Bicyclo[1.1.1]pentan-1,3-dicarboxylic acid-1-methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acid
CAS:Formula:C8H10O4Purity:98%Color and Shape:SolidMolecular weight:170.1626Ref: IN-DA0057I0
250gTo inquire250mg23.00€1g25.00€100mg26.00€5g67.00€10g100.00€25g185.00€50g264.00€100g662.00€3-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acid
CAS:Formula:C8H10O4Purity:95%Color and Shape:Solid, Crystalline PowderMolecular weight:170.1643-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic Acid
CAS:Formula:C8H10O4Purity:>97.0%(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:170.163-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acid
CAS:3-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acidFormula:C8H10O4Purity:95%Color and Shape: off-white solidMolecular weight:170.16g/mol1,1'-Bicyclo[1,1,1]pentane-1,3-dicarboxylic acid monomethyl ester
CAS:1,1'-Bicyclo[1,1,1]pentane-1,3-dicarboxylic acid monomethyl ester is a chemical compound used in research and as a building block for complex compounds. It is a high quality and versatile compound that has a wide range of uses in the production of fine chemicals. This compound is an intermediate for the synthesis of 1,4-benzodioxan. CAS No. 83249-10-9
Formula:C8H10O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:170.16 g/mol




