CAS 83249-52-9
:5-[2-(3,4-Dichlorophenyl)diazenyl]-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinecarbonitrile
Description:
5-[2-(3,4-Dichlorophenyl)diazenyl]-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinecarbonitrile, with the CAS number 83249-52-9, is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring, a diazenyl group, and multiple functional groups such as hydroxyl and cyano groups. This compound typically exhibits properties associated with azo dyes, including vibrant coloration and potential applications in dyeing and pigment formulations. The presence of the dichlorophenyl moiety may impart specific electronic and steric effects, influencing its reactivity and solubility. Additionally, the hydroxyl and cyano groups can participate in hydrogen bonding and other intermolecular interactions, affecting the compound's stability and behavior in various solvents. Its unique structure suggests potential biological activity, making it of interest in medicinal chemistry and material science. However, detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C14H10Cl2N4O2
InChI:InChI=1S/C14H10Cl2N4O2/c1-7-9(6-17)13(21)20(2)14(22)12(7)19-18-8-3-4-10(15)11(16)5-8/h3-5,22H,1-2H3
InChI key:InChIKey=OHXVEPRYGPIKAN-UHFFFAOYSA-N
SMILES:N(=NC1=CC(Cl)=C(Cl)C=C1)C=2C(C)=C(C#N)C(=O)N(C)C2O
Synonyms:- (5E)-5-[2-(3,4-dichlorophenyl)hydrazinylidene]-1,4-dimethyl-2,6-dioxo-1,2,5,6-tetrahydropyridine-3-carbonitrile
- 3-Pyridinecarbonitrile, 5-[(3,4-dichlorophenyl)azo]-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-
- 3-Pyridinecarbonitrile, 5-[2-(3,4-dichlorophenyl)diazenyl]-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-
- 5-[2-(3,4-Dichlorophenyl)diazenyl]-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinecarbonitrile
- Disperse Yellow 241
- Resolin Yellow 5GL
- C.I. 128450
- C.I. Disperse Yellow 241
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Disperse yellow 241
CAS:Disperse Yellow 241 is a synthetic dye that has a hydrophobic nature and a reactive property. It is used as a colorant in paints, plastics, textiles, and paper. Disperse Yellow 241 has an ionizable property and can be cleaved by hydrolysis to produce reactive radicals. The monolayer of this dye is stable at temperatures up to 80°C and in the presence of amines.
Formula:C14H10Cl2N4O2Color and Shape:PowderMolecular weight:337.16 g/mol
