CAS 83253-29-6

N-hydroxy-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanimine

Description:

N-hydroxy-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanimine, with the CAS number 83253-29-6, is a chemical compound characterized by its unique structure that includes an imidazo-thiazole moiety and a hydroxylamine functional group. This compound is of interest in various fields, including medicinal chemistry and toxicology, due to its potential biological activities. The presence of the hydroxylamine group suggests that it may participate in redox reactions, potentially acting as a nucleophile or a reactive intermediate. The imidazo-thiazole structure is known for its role in biological systems and may contribute to the compound's reactivity and interaction with biological targets. Additionally, the methyl group on the imidazole ring can influence the compound's lipophilicity and solubility, affecting its pharmacokinetic properties. Overall, N-hydroxy-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanimine presents a complex profile that warrants further investigation to fully understand its chemical behavior and potential applications.

Formula: C₇H₇N₃OS

InChI: InChI=1/C7H7N3OS/c1-5-6(4-8-11)10-2-3-12-7(10)9-5/h2-4,11H,1H3

SMILES: Cc1c(C=NO)n2ccsc2n1

N-({6-Methylimidazo[2,1-b][1,3]thiazol-5-yl}methylidene)hydroxylamine

CAS: 83253-29-6

Versatile small molecule scaffold

Formula: C₇H₇N₃OS

Purity: Min. 95%

Molecular weight: 181.22 g/mol

Ref: 3D-IDA25329