CymitQuimica logo

CAS 83253-30-9

:

6-Phenylimidazo[2,1-b]thiazole-5-carboxaldehyde oxime

Description:
6-Phenylimidazo[2,1-b]thiazole-5-carboxaldehyde oxime is a chemical compound characterized by its unique structural features, which include an imidazole ring fused with a thiazole moiety and a carboxaldehyde oxime functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of the oxime functional group, which can participate in various chemical reactions, including condensation and nucleophilic addition. The phenyl group contributes to its aromatic character, potentially influencing its solubility and interaction with biological targets. The compound may be of interest in medicinal chemistry and material science due to its structural complexity and potential applications in drug development or as a precursor in organic synthesis. Additionally, its specific reactivity and stability can be influenced by environmental factors such as pH and temperature. As with many heterocycles, the compound's properties can be further explored through various analytical techniques to understand its behavior in different chemical contexts.
Formula:C12H9N3OS
InChI:InChI=1S/C12H9N3OS/c16-13-8-10-11(9-4-2-1-3-5-9)14-12-15(10)6-7-17-12/h1-8,16H
InChI key:InChIKey=ZDHZMNLEASUBCM-UHFFFAOYSA-N
SMILES:C(=NO)C1=C(N=C2N1C=CS2)C3=CC=CC=C3
Synonyms:
  • 6-Phenylimidazo[2,1-b]thiazole-5-carboxaldehyde oxime
  • Imidazo[2,1-b]thiazole-5-carboxaldehyde, 6-phenyl-, oxime
  • NSC 332731
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.