
CAS 83253-35-4
:6-Phenylimidazo[2,1-b]thiazole-5-carbonitrile
Description:
6-Phenylimidazo[2,1-b]thiazole-5-carbonitrile is a heterocyclic compound characterized by its unique structure, which includes an imidazole ring fused to a thiazole ring, along with a phenyl group and a cyano group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of the cyano group contributes to its reactivity and may influence its interaction with biological targets. Additionally, the imidazo and thiazole moieties are known for their roles in various pharmacological activities, including antimicrobial and anticancer properties. The compound's molecular structure allows for various synthetic modifications, which can enhance its biological efficacy or alter its physicochemical properties. Overall, 6-Phenylimidazo[2,1-b]thiazole-5-carbonitrile represents a class of compounds that may serve as valuable scaffolds in the design of new therapeutic agents.
Formula:C12H7N3S
InChI:InChI=1S/C12H7N3S/c13-8-10-11(9-4-2-1-3-5-9)14-12-15(10)6-7-16-12/h1-7H
InChI key:InChIKey=RHVWNUWUBFINSN-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N=C2N1C=CS2)C3=CC=CC=C3
Synonyms:- Imidazo[2,1-b]thiazole-5-carbonitrile, 6-phenyl-
- NSC 332732
- 6-Phenylimidazo[2,1-b]thiazole-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.