CymitQuimica logo

CAS 83255-87-2

:

3-Bromo-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Description:
3-Bromo-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a bromine atom at the 3-position and a methyl group at the 1-position of the pyrazole ring, along with an amino group at the 4-position of the pyrimidine ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which can be explored in pharmacological studies. As with many heterocycles, it may also display unique optical and electronic properties, contributing to its utility in various applications.
Formula:C6H6BrN5
InChI:InChI=1S/C6H6BrN5/c1-12-6-3(4(7)11-12)5(8)9-2-10-6/h2H,1H3,(H2,8,9,10)
InChI key:InChIKey=DHFYKLULHRGVSL-UHFFFAOYSA-N
SMILES:NC1=C2C(N(C)N=C2Br)=NC=N1
Synonyms:
  • 1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 3-bromo-1-methyl-
  • 3-Bromo-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.