CAS 83259-32-9

Thieno[2,3-d]pyrimidine, 2-chloro-5,6-dimethyl-

Description:

Thieno[2,3-d]pyrimidine, 2-chloro-5,6-dimethyl- is a heterocyclic organic compound characterized by a fused thieno and pyrimidine ring system. This compound features a chlorine atom at the 2-position and two methyl groups at the 5 and 6 positions of the pyrimidine ring. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the thieno ring enhances its electronic properties, which can influence its reactivity and interactions with biological targets. Typically, compounds of this class may exhibit various pharmacological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. The compound is likely to be soluble in organic solvents and may have moderate stability under standard laboratory conditions. Its CAS number, 83259-32-9, allows for easy identification and retrieval of information regarding its properties and applications in scientific literature.

Formula: C₈H₇ClN₂S

InChI: InChI=1S/C8H7ClN2S/c1-4-5(2)12-7-6(4)3-10-8(9)11-7/h3H,1-2H3

InChI key: InChIKey=XXTQANLYJPBPNP-UHFFFAOYSA-N

SMILES: CC=1C=2C(SC1C)=NC(Cl)=NC2

Synonyms:

• 2-Chloro-5,6-dimethylthieno[2,3-d]pyrimidine
• Thieno[2,3-d]pyrimidine, 2-chloro-5,6-dimethyl-