CAS 83260-96-2
:4-chloro-2-methylquinolinium chloride
Description:
4-Chloro-2-methylquinolinium chloride is a chemical compound characterized by its quinolinium structure, which consists of a quinoline ring with a chlorine substituent at the fourth position and a methyl group at the second position. This compound typically appears as a solid, often in crystalline form, and is soluble in polar solvents such as water and alcohols due to the presence of the chloride ion. It exhibits properties typical of quaternary ammonium compounds, including potential antimicrobial activity, making it of interest in various biological and chemical applications. The presence of the chlorine atom can influence its reactivity and stability, while the methyl group may affect its lipophilicity. As with many quinolinium derivatives, it may also exhibit fluorescence, which can be useful in analytical applications. Safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled. Overall, 4-chloro-2-methylquinolinium chloride is a versatile compound with applications in research and industry.
Formula:C10H9Cl2N
InChI:InChI=1/C10H8ClN.ClH/c1-7-6-9(11)8-4-2-3-5-10(8)12-7;/h2-6H,1H3;1H
SMILES:Cc1cc(c2ccccc2n1)Cl.Cl
Synonyms:- 4-Chloro-2-methylquinoline hydrochloride (1:1)
- Quinoline, 4-Chloro-2-Methyl-, Hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
