CymitQuimica logo

CAS 832674-19-8

:

4-Butoxy-3-chloro-5-ethoxybenzaldehyde

Description:
4-Butoxy-3-chloro-5-ethoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a butoxy group and an ethoxy group, contributing to its solubility and reactivity. The presence of a chlorine atom at the 3-position of the benzene ring introduces electrophilic characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests moderate polarity due to the presence of ether and aldehyde functionalities, which can influence its interactions in different solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its unique combination of functional groups can lead to diverse applications in organic synthesis and material science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential hazards associated with its components.
Formula:C13H17ClO3
InChI:InChI=1S/C13H17ClO3/c1-3-5-6-17-13-11(14)7-10(9-15)8-12(13)16-4-2/h7-9H,3-6H2,1-2H3
InChI key:InChIKey=NXLRBEDXIXAZJA-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OCCCC)C(Cl)=CC(C=O)=C1
Synonyms:
  • 4-Butoxy-3-chloro-5-ethoxybenzaldehyde
  • Benzaldehyde, 4-butoxy-3-chloro-5-ethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.