CymitQuimica logo

CAS 832674-36-9

:

2-(4-Formyl-2-methoxyphenoxy)-N-(2-phenylethyl)acetamide

Description:
2-(4-Formyl-2-methoxyphenoxy)-N-(2-phenylethyl)acetamide, with the CAS number 832674-36-9, is an organic compound characterized by its complex structure, which includes a phenoxy group, an acetamide moiety, and a formyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The formyl group can participate in various chemical reactions, such as condensation and reduction, while the acetamide functionality may impart stability and influence the compound's pharmacological properties. Due to its structural features, this compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, this compound represents a unique structure that could be of interest in the development of new therapeutic agents.
Formula:C18H19NO4
InChI:InChI=1S/C18H19NO4/c1-22-17-11-15(12-20)7-8-16(17)23-13-18(21)19-10-9-14-5-3-2-4-6-14/h2-8,11-12H,9-10,13H2,1H3,(H,19,21)
InChI key:InChIKey=XGGDFLIUHJKABK-UHFFFAOYSA-N
SMILES:O(CC(NCCC1=CC=CC=C1)=O)C2=C(OC)C=C(C=O)C=C2
Synonyms:
  • Acetamide, 2-(4-formyl-2-methoxyphenoxy)-N-(2-phenylethyl)-
  • 2-(4-Formyl-2-methoxyphenoxy)-N-(2-phenylethyl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.