CAS 832674-48-3

2,3-Dibromo-4-[(2-chlorophenyl)methoxy]-5-methoxybenzaldehyde

Description:

2,3-Dibromo-4-[(2-chlorophenyl)methoxy]-5-methoxybenzaldehyde is an organic compound characterized by its complex structure, which includes multiple functional groups. It features a benzaldehyde moiety, indicating the presence of an aldehyde functional group, which is typically reactive and can participate in various chemical reactions, such as condensation and oxidation. The compound also contains bromine and chlorine substituents, which can influence its reactivity and solubility. The presence of methoxy groups enhances its lipophilicity, potentially affecting its biological activity and interaction with other molecules. This compound may exhibit interesting properties, such as antimicrobial or anticancer activities, due to the halogenated aromatic structure. Its synthesis and applications could be relevant in medicinal chemistry and material science. As with many organic compounds, safety precautions should be taken when handling it, as halogenated compounds can pose environmental and health risks. Overall, 2,3-Dibromo-4-[(2-chlorophenyl)methoxy]-5-methoxybenzaldehyde represents a versatile structure with potential utility in various chemical applications.

Formula: C₁₅H₁₁Br₂ClO₃

InChI: InChI=1S/C15H11Br2ClO3/c1-20-12-6-10(7-19)13(16)14(17)15(12)21-8-9-4-2-3-5-11(9)18/h2-7H,8H2,1H3

InChI key: InChIKey=XSHGMUIGZUUDHE-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=CC=C1)C2=C(OC)C=C(C=O)C(Br)=C2Br

Synonyms:

• 2,3-Dibromo-4-[(2-chlorophenyl)methoxy]-5-methoxybenzaldehyde
• Benzaldehyde, 2,3-dibromo-4-[(2-chlorophenyl)methoxy]-5-methoxy-