CAS 832674-51-8

2,3-Dibromo-4-[(2-chlorophenyl)methoxy]-5-ethoxybenzaldehyde

Description:

2,3-Dibromo-4-[(2-chlorophenyl)methoxy]-5-ethoxybenzaldehyde is an organic compound characterized by its complex structure, which includes multiple functional groups. It features a benzaldehyde moiety, indicating the presence of an aldehyde functional group, which is typically reactive and can participate in various chemical reactions, such as condensation and oxidation. The compound also contains bromine and chlorine substituents, which can influence its reactivity and solubility, as halogens often enhance electrophilic character. The ethoxy group contributes to the compound's hydrophobic characteristics, potentially affecting its solubility in organic solvents. The presence of the methoxy group further adds to its structural complexity and may influence its electronic properties. This compound may be of interest in medicinal chemistry or materials science due to its unique substituents, which can affect biological activity or physical properties. As with many organic compounds, safety precautions should be taken when handling it, as halogenated compounds can pose health risks.

Formula: C₁₆H₁₃Br₂ClO₃

InChI: InChI=1S/C16H13Br2ClO3/c1-2-21-13-7-11(8-20)14(17)15(18)16(13)22-9-10-5-3-4-6-12(10)19/h3-8H,2,9H2,1H3

InChI key: InChIKey=PLUCUZQWBLMBFC-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=CC=C1)C2=C(OCC)C=C(C=O)C(Br)=C2Br

Synonyms:

• Benzaldehyde, 2,3-dibromo-4-[(2-chlorophenyl)methoxy]-5-ethoxy-
• 2,3-Dibromo-4-[(2-chlorophenyl)methoxy]-5-ethoxybenzaldehyde