CAS 832674-52-9

5-Bromo-2-butoxy-3-iodobenzaldehyde

Description:

5-Bromo-2-butoxy-3-iodobenzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde moiety substituted with both bromine and iodine atoms, as well as a butoxy group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the aldehyde functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The halogen substituents (bromine and iodine) can influence the compound's reactivity and stability, often making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the butoxy group contributes to the compound's solubility properties, potentially enhancing its compatibility with organic solvents. Safety considerations should be taken into account when handling this compound, as halogenated organic compounds can pose health risks. Overall, 5-Bromo-2-butoxy-3-iodobenzaldehyde serves as a valuable intermediate in chemical synthesis.

Formula: C₁₁H₁₂BrIO₂

InChI: InChI=1S/C11H12BrIO2/c1-2-3-4-15-11-8(7-14)5-9(12)6-10(11)13/h5-7H,2-4H2,1H3

InChI key: InChIKey=DKMBNBICCFKLSC-UHFFFAOYSA-N

SMILES: O(CCCC)C1=C(C=O)C=C(Br)C=C1I

Synonyms:

• 5-Bromo-2-butoxy-3-iodobenzaldehyde
• Benzaldehyde, 5-bromo-2-butoxy-3-iodo-