CAS 832674-53-0
:4-(Benzoyloxy)-3-chloro-5-methoxybenzaldehyde
Description:
4-(Benzoyloxy)-3-chloro-5-methoxybenzaldehyde, with the CAS number 832674-53-0, is an organic compound characterized by its complex aromatic structure. It features a benzaldehyde functional group, which is indicative of its potential reactivity in various chemical reactions, particularly in electrophilic aromatic substitution. The presence of a chloro group and a methoxy group on the aromatic ring contributes to its unique electronic properties, influencing its reactivity and solubility. The benzoyloxy substituent enhances its stability and may also affect its interaction with biological systems, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its synthesis and applications may be relevant in the development of pharmaceuticals or agrochemicals, where such substituted aromatic aldehydes can serve as intermediates or active ingredients. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C15H11ClO4
InChI:InChI=1S/C15H11ClO4/c1-19-13-8-10(9-17)7-12(16)14(13)20-15(18)11-5-3-2-4-6-11/h2-9H,1H3
InChI key:InChIKey=LKQHMRINVZNETQ-UHFFFAOYSA-N
SMILES:O(C(=O)C1=CC=CC=C1)C2=C(OC)C=C(C=O)C=C2Cl
Synonyms:- 4-(Benzoyloxy)-3-chloro-5-methoxybenzaldehyde
- Benzaldehyde, 4-(benzoyloxy)-3-chloro-5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.