CymitQuimica logo

CAS 832674-62-1

:

2,3-Dibromo-4-butoxy-5-ethoxybenzaldehyde

Description:
2,3-Dibromo-4-butoxy-5-ethoxybenzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde functional group, two bromine atoms, and two ether substituents. The presence of bromine atoms typically imparts increased reactivity and can influence the compound's physical properties, such as solubility and boiling point. The butoxy and ethoxy groups enhance the compound's hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound may exhibit interesting chemical behavior due to the electron-withdrawing effects of the bromine atoms and the electron-donating effects of the alkoxy groups, potentially affecting its reactivity in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the aldehyde functional group can participate in condensation reactions and can be a site for further functionalization. Overall, 2,3-Dibromo-4-butoxy-5-ethoxybenzaldehyde is a versatile compound with potential applications in organic synthesis and material science.
Formula:C13H16Br2O3
InChI:InChI=1S/C13H16Br2O3/c1-3-5-6-18-13-10(17-4-2)7-9(8-16)11(14)12(13)15/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=FYAZYPXGXNFTLD-UHFFFAOYSA-N
SMILES:O(CCCC)C1=C(OCC)C=C(C=O)C(Br)=C1Br
Synonyms:
  • Benzaldehyde, 2,3-dibromo-4-butoxy-5-ethoxy-
  • 2,3-Dibromo-4-butoxy-5-ethoxybenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.