CAS 832674-63-2

2-(2-Bromo-6-ethoxy-4-formylphenoxy)acetonitrile

Description:

2-(2-Bromo-6-ethoxy-4-formylphenoxy)acetonitrile, with the CAS number 832674-63-2, is a chemical compound characterized by its complex structure, which includes a brominated aromatic ring, an ethoxy group, and a formyl group. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, making it a versatile intermediate in organic synthesis. The presence of the bromine atom suggests potential reactivity in nucleophilic substitution reactions, while the acetonitrile moiety can participate in various coupling reactions. The ethoxy group may enhance solubility in organic solvents, facilitating its use in chemical reactions. Additionally, the formyl group indicates that this compound can undergo further transformations, such as reduction or condensation reactions. Overall, 2-(2-Bromo-6-ethoxy-4-formylphenoxy)acetonitrile is of interest in medicinal chemistry and materials science due to its potential applications in drug development and the synthesis of complex organic molecules.

Formula: C₁₁H₁₀BrNO₃

InChI: InChI=1S/C11H10BrNO3/c1-2-15-10-6-8(7-14)5-9(12)11(10)16-4-3-13/h5-7H,2,4H2,1H3

InChI key: InChIKey=YYGUYTQPRDMNEH-UHFFFAOYSA-N

SMILES: O(CC)C1=C(OCC#N)C(Br)=CC(C=O)=C1

Synonyms:

• 2-(2-Bromo-6-ethoxy-4-formylphenoxy)acetonitrile
• Acetonitrile, 2-(2-bromo-6-ethoxy-4-formylphenoxy)-
• Acetonitrile, (2-bromo-6-ethoxy-4-formylphenoxy)-

(2-Bromo-6-ethoxy-4-formylphenoxy)acetonitrile

CAS: 832674-63-2

Versatile small molecule scaffold

Formula: C₁₁H₁₀BrNO₃

Purity: Min. 95%

Molecular weight: 284.11 g/mol

Ref: 3D-HIB67463