CymitQuimica logo

CAS 832674-66-5

:

Ethyl 2-(4-bromo-2-formyl-6-iodophenoxy)acetate

Description:
Ethyl 2-(4-bromo-2-formyl-6-iodophenoxy)acetate is an organic compound characterized by its complex structure, which includes an ethyl ester functional group and a phenoxy moiety substituted with both bromo and iodo atoms, as well as a formyl group. This compound typically exhibits moderate to high polarity due to the presence of electronegative halogens and the carbonyl group, which can influence its solubility in various solvents. The presence of halogens (bromine and iodine) often imparts unique reactivity, making it a potential candidate for further chemical transformations or applications in medicinal chemistry. Additionally, the compound may exhibit biological activity, which is common for halogenated aromatic compounds, potentially making it useful in pharmaceutical research. Its molecular structure suggests that it could participate in various reactions, such as nucleophilic substitutions or coupling reactions, depending on the conditions. Overall, Ethyl 2-(4-bromo-2-formyl-6-iodophenoxy)acetate is a compound of interest in organic synthesis and medicinal chemistry due to its unique functional groups and potential reactivity.
Formula:C11H10BrIO4
InChI:InChI=1S/C11H10BrIO4/c1-2-16-10(15)6-17-11-7(5-14)3-8(12)4-9(11)13/h3-5H,2,6H2,1H3
InChI key:InChIKey=SWVHQKAQIRVMNV-UHFFFAOYSA-N
SMILES:O(CC(OCC)=O)C1=C(C=O)C=C(Br)C=C1I
Synonyms:
  • Ethyl 2-(4-bromo-2-formyl-6-iodophenoxy)acetate
  • Acetic acid, 2-(4-bromo-2-formyl-6-iodophenoxy)-, ethyl ester
  • Acetic acid, (4-bromo-2-formyl-6-iodophenoxy)-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.