CymitQuimica logo

CAS 832684-43-2

:

5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxylic acid

Description:
5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a benzoxazole ring fused with a saturated carbon framework. This compound features a tert-butyl group, contributing to its hydrophobic characteristics and potentially influencing its solubility and reactivity. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. The tetrahydro configuration suggests that the compound is saturated, which can affect its stability and reactivity compared to unsaturated analogs. Additionally, the benzoxazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological activity and chemical behavior.
Formula:C12H17NO3
InChI:InChI=1S/C12H17NO3/c1-12(2,3)7-4-5-9-8(6-7)10(11(14)15)13-16-9/h7H,4-6H2,1-3H3,(H,14,15)
InChI key:YAICHDLMXOAJLD-UHFFFAOYSA-N
SMILES:CC(C)(C)C1CCc2c(C1)c(C(=O)O)no2
Synonyms:
  • 1,2-Benzisoxazole-3-carboxylic acid, 5-(1,1-dimethylethyl)-4,5,6,7-tetrahydro-
Found 5 products.