CAS 832695-88-2
:[3-(Methylcarbamoyl)phenyl]boronic acid
Description:
[3-(Methylcarbamoyl)phenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a methylcarbamoyl group. This compound typically exhibits properties associated with both boronic acids and amides, including the ability to form reversible covalent bonds with diols, making it useful in various applications such as organic synthesis and medicinal chemistry. The boronic acid moiety allows for participation in Suzuki coupling reactions, which are valuable in the formation of carbon-carbon bonds. Additionally, the methylcarbamoyl group contributes to the compound's solubility and reactivity, influencing its interaction with biological targets. The compound is likely to be a solid at room temperature and may exhibit moderate stability under standard conditions, although it can be sensitive to moisture due to the presence of the boronic acid group. Overall, [3-(Methylcarbamoyl)phenyl]boronic acid serves as a versatile building block in the development of pharmaceuticals and agrochemicals.
Formula:C8H10BNO3
InChI:InChI=1/C8H10BNO3/c1-10-8(11)6-3-2-4-7(5-6)9(12)13/h2-5,12-13H,1H3,(H,10,11)
SMILES:CN=C(c1cccc(c1)B(O)O)O
Synonyms:- boronic acid, B-[3-[(methylamino)carbonyl]phenyl]-
- 3-(Methylcarbamoyl)benzeneboronic acid
- 3-(N-Methylaminocarbonyl)phenylboronic acid
- 3-(Methylcarbamoyl)Phenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(Methylcarbamoyl)benzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H10BNO3Purity:98%Molecular weight:178.983-(N-METHYLAMINOCARBONYL)PHENYLBORONIC ACID
CAS:Formula:C8H10BNO3Purity:97%Color and Shape:SolidMolecular weight:178.9809Ref: IN-DA004TUS
75gTo inquire100gTo inquire250mg26.00€100mg28.00€1g51.00€5g109.00€10g163.00€15g194.00€25g214.00€50g502.00€3-(Methylcarbamoyl)benzeneboronic acid
CAS:3-(Methylcarbamoyl)benzeneboronic acidFormula:C8H10BNO3Purity:98%Color and Shape: white powderMolecular weight:178.98g/mol3-(Methylcarbamoyl)benzeneboronic acid
CAS:Formula:C8H10BNO3Purity:98%Color and Shape:SolidMolecular weight:178.98



