CAS 832715-05-6
:1-[[3-(1-Methylethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-pyrrolidinol
Description:
1-[[3-(1-Methylethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-pyrrolidinol is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an oxadiazole moiety. The presence of the 1-methylethyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The oxadiazole ring is known for its role in various biological activities, including antimicrobial and anti-inflammatory properties. The compound's functional groups suggest it may engage in hydrogen bonding, which can affect its reactivity and stability. Additionally, the pyrrolidinol portion may impart certain pharmacological properties, making it of interest in medicinal chemistry. Overall, this compound's structural features suggest potential applications in drug development, although specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C10H17N3O2
InChI:InChI=1S/C10H17N3O2/c1-7(2)10-11-9(15-12-10)6-13-4-3-8(14)5-13/h7-8,14H,3-6H2,1-2H3
InChI key:InChIKey=YDHGWCIEXVZAQC-UHFFFAOYSA-N
SMILES:C(C1=NC(C(C)C)=NO1)N2CC(O)CC2
Synonyms:- 3-Pyrrolidinol, 1-[[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]methyl]-
- 1-[(3-Propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]pyrrolidin-3-ol
- 3-Hydroxy-1-[(3-isopropyl-1,2,4-oxadiazol-5-yl)methyl]pyrrolidine
- 1-[[3-(1-Methylethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-pyrrolidinol
- 1-[[3-(Propan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrrolidin-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.