CymitQuimica logo

CAS 832715-99-8

:

3-Pyridinecarboxylic acid, 6-(1,1-dimethylethyl)-

Description:
3-Pyridinecarboxylic acid, 6-(1,1-dimethylethyl)-, also known by its CAS number 832715-99-8, is an organic compound characterized by a pyridine ring substituted with a carboxylic acid group and a tert-butyl group. This compound features a pyridine structure, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for forming hydrogen bonds. The presence of the carboxylic acid group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The tert-butyl group enhances the compound's hydrophobic characteristics and steric bulk, which can influence its reactivity and interactions with other molecules. This compound may be of interest in pharmaceutical and agrochemical research due to its potential biological activities and applications in synthesis. Its solubility, stability, and reactivity can vary depending on environmental conditions, making it important to consider these factors in practical applications.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-10(2,3)8-5-4-7(6-11-8)9(12)13/h4-6H,1-3H3,(H,12,13)
InChI key:CVGXKEVUQXTBGM-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=NC=C(C=C1)C(=O)O
Found 5 products.