CAS 832735-60-1

7-bromo[1,2,4]triazolo[4,3-a]pyridine

Description:

7-Bromo[1,2,4]triazolo[4,3-a]pyridine is a heterocyclic compound characterized by its fused triazole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 7-position enhances its reactivity and can influence its biological activity. This compound typically exhibits a planar structure, allowing for effective π-π stacking interactions, which can be significant in biological systems and material science applications. It is often soluble in polar organic solvents, making it suitable for various synthetic and analytical applications. The triazole moiety is known for its ability to form hydrogen bonds, which can enhance its interactions with biological targets, potentially making it of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence properties, which can be useful in imaging and sensing applications. Overall, 7-bromo[1,2,4]triazolo[4,3-a]pyridine is a versatile compound with potential applications in pharmaceuticals and materials science due to its unique structural features and reactivity.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-5-1-2-10-4-8-9-6(10)3-5/h1-4H

SMILES: c1cn2cnnc2cc1Br

Synonyms:

• 1,2,4-Triazolo[4,3-a]pyridine, 7-bromo-
• 7-Bromo[1,2,4]triazolo[4,3-a]pyridine

7-Bromo-[1,2,4]triazolo[4,3-a]pyridine

CAS: 832735-60-1

Formula: C₆H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA0055XH

7-Bromo[1,2,4]triazolo[4,3-a]pyridine

CAS: 832735-60-1

7-Bromo[1,2,4]triazolo[4,3-a]pyridine

Purity: 98%

Molecular weight: 198.02g/mol

Ref: 54-OR904778

7-Bromo[1,2,4]triazolo[4,3-a]pyridine

CAS: 832735-60-1

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F093206