CymitQuimica logo

CAS 832737-17-4

:

3-(Difluoromethyl)-6-methyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine

Description:
3-(Difluoromethyl)-6-methyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine is a heterocyclic compound characterized by its unique triazole and thiadiazine ring structures. This compound features a difluoromethyl group, which contributes to its chemical reactivity and potential biological activity. The presence of the methyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The triazole and thiadiazine moieties are known for their diverse pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. The compound's stability, reactivity, and interaction with biological targets would depend on its specific electronic and steric properties, which are influenced by the arrangement of its functional groups. Overall, 3-(Difluoromethyl)-6-methyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine represents a complex and potentially valuable chemical entity in various fields of research.
Formula:C6H6F2N4S
InChI:InChI=1S/C6H6F2N4S/c1-3-2-13-6-10-9-5(4(7)8)12(6)11-3/h4H,2H2,1H3
InChI key:InChIKey=LYIVLHOHXKGTBS-UHFFFAOYSA-N
SMILES:C(F)(F)C=1N2C(=NN1)SCC(C)=N2
Synonyms:
  • 7H-1,2,4-Triazolo[3,4-b][1,3,4]thiadiazine, 3-(difluoromethyl)-6-methyl-
  • 3-(Difluoromethyl)-6-methyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.