CAS 832737-28-7

1-[(3-Nitrophenyl)sulfonyl]-4-piperidinecarboxylic acid hydrazide

Description:

1-[(3-Nitrophenyl)sulfonyl]-4-piperidinecarboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylic acid group, and a hydrazide functional group. The presence of a nitrophenyl group suggests that it may exhibit significant electronic properties, potentially influencing its reactivity and interactions. The sulfonyl group enhances its solubility in polar solvents and may also contribute to its biological activity. This compound is likely to be of interest in medicinal chemistry, particularly for its potential applications in drug development, given the presence of functional groups that can participate in various chemical reactions. Additionally, the hydrazide moiety may be involved in forming hydrazones or other derivatives, which can be relevant in the synthesis of more complex molecules. Overall, the unique combination of functional groups in this compound suggests a diverse range of potential applications in pharmaceuticals and materials science.

Formula: C₁₂H₁₆N₄O₅S

InChI: InChI=1S/C12H16N4O5S/c13-14-12(17)9-4-6-15(7-5-9)22(20,21)11-3-1-2-10(8-11)16(18)19/h1-3,8-9H,4-7,13H2,(H,14,17)

InChI key: InChIKey=IBWZNIDHXHTJDY-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(N(=O)=O)=CC=C1)N2CCC(C(NN)=O)CC2

Synonyms:

• 1-[(3-Nitrophenyl)sulfonyl]-4-piperidinecarboxylic acid hydrazide
• 4-Piperidinecarboxylic acid, 1-[(3-nitrophenyl)sulfonyl]-, hydrazide