CAS 832737-29-8
:4-Cyclopropyl-2-(ethylsulfonyl)-6-(trifluoromethyl)pyrimidine
Description:
4-Cyclopropyl-2-(ethylsulfonyl)-6-(trifluoromethyl)pyrimidine is a synthetic organic compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. The presence of a cyclopropyl group introduces strain and unique reactivity, while the ethylsulfonyl moiety contributes to its solubility and potential biological activity. The trifluoromethyl group enhances lipophilicity and can influence the compound's pharmacokinetic properties. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its structural features suggest it may exhibit interesting interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, the presence of fluorine atoms typically increases metabolic stability and can modulate the compound's electronic properties, which may be advantageous in therapeutic contexts. Overall, the unique combination of functional groups in this compound contributes to its potential utility in various chemical and biological applications.
Formula:C10H11F3N2O2S
InChI:InChI=1S/C10H11F3N2O2S/c1-2-18(16,17)9-14-7(6-3-4-6)5-8(15-9)10(11,12)13/h5-6H,2-4H2,1H3
InChI key:InChIKey=FIEUVTARHGRRPQ-UHFFFAOYSA-N
SMILES:S(CC)(=O)(=O)C=1N=C(C=C(C(F)(F)F)N1)C2CC2
Synonyms:- 4-Cyclopropyl-2-(ethylsulfonyl)-6-(trifluoromethyl)pyrimidine
- Pyrimidine, 4-cyclopropyl-2-(ethylsulfonyl)-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.