CAS 832737-30-1
:Methyl 2-amino-4-[4-(difluoromethoxy)phenyl]-3-thiophenecarboxylate
Description:
Methyl 2-amino-4-[4-(difluoromethoxy)phenyl]-3-thiophenecarboxylate, with the CAS number 832737-30-1, is a chemical compound characterized by its complex structure, which includes a thiophene ring, an amino group, and a difluoromethoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the difluoromethoxy group may enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Methyl esters, like this compound, are often used in medicinal chemistry for their ability to serve as prodrugs or intermediates in the synthesis of more complex molecules. Additionally, the thiophene moiety can contribute to electronic properties, making it of interest in materials science and organic electronics. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals and agrochemicals, although specific biological activities would require further investigation.
Formula:C13H11F2NO3S
InChI:InChI=1S/C13H11F2NO3S/c1-18-12(17)10-9(6-20-11(10)16)7-2-4-8(5-3-7)19-13(14)15/h2-6,13H,16H2,1H3
InChI key:InChIKey=CHNDCAYAQSPKNL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(=CSC1N)C2=CC=C(OC(F)F)C=C2
Synonyms:- Methyl 2-amino-4-[4-(difluoromethoxy)phenyl]-3-thiophenecarboxylate
- 3-Thiophenecarboxylic acid, 2-amino-4-[4-(difluoromethoxy)phenyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.