CAS 832737-31-2

2-[(5-Formyl-2-furanyl)methoxy]benzamide

Description:

2-[(5-Formyl-2-furanyl)methoxy]benzamide, with the CAS number 832737-31-2, is an organic compound characterized by its unique structural features. It contains a benzamide moiety, which is a derivative of benzoic acid where the carboxylic acid group is replaced by an amide group. The presence of a methoxy group linked to a furan ring, specifically a 5-formyl-2-furanyl group, contributes to its reactivity and potential biological activity. This compound may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential interactions with biological targets due to its functional groups. The furan ring, known for its aromaticity and electron-rich nature, can participate in various chemical reactions, making this compound of interest in medicinal chemistry and organic synthesis. Its specific applications and biological activities would depend on further research and characterization, including studies on its pharmacological properties and potential uses in drug development.

Formula: C₁₃H₁₁NO₄

InChI: InChI=1S/C13H11NO4/c14-13(16)11-3-1-2-4-12(11)17-8-10-6-5-9(7-15)18-10/h1-7H,8H2,(H2,14,16)

InChI key: InChIKey=UHVGQQPSEANEMS-UHFFFAOYSA-N

SMILES: O(CC=1OC(C=O)=CC1)C2=C(C(N)=O)C=CC=C2

2-[(5-Formylfuran-2-yl)methoxy]benzamide

CAS: 832737-31-2

Versatile small molecule scaffold

Formula: C₁₃H₁₁NO₄

Purity: Min. 95%

Molecular weight: 245.23 g/mol

Ref: 3D-HIB73731