CAS 832737-40-3

1-[4-Methyl-6-(trifluoromethyl)-2-pyrimidinyl]-4-piperidinecarboxylic acid

Description:

1-[4-Methyl-6-(trifluoromethyl)-2-pyrimidinyl]-4-piperidinecarboxylic acid, with the CAS number 832737-40-3, is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a piperidine moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The methyl group on the pyrimidine ring can also affect its electronic properties and steric hindrance. As a carboxylic acid, it can participate in acid-base reactions and may form salts or esters under appropriate conditions. The compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its reactivity, stability, and biological interactions.

Formula: C₁₂H₁₄F₃N₃O₂

InChI: InChI=1S/C12H14F3N3O2/c1-7-6-9(12(13,14)15)17-11(16-7)18-4-2-8(3-5-18)10(19)20/h6,8H,2-5H2,1H3,(H,19,20)

InChI key: InChIKey=DNHULROXXDYNPF-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=NC(=NC(C)=C1)N2CCC(C(O)=O)CC2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[4-methyl-6-(trifluoromethyl)-2-pyrimidinyl]-
• 1-[4-Methyl-6-(trifluoromethyl)-2-pyrimidinyl]-4-piperidinecarboxylic acid

1-[4-Methyl-6-(trifluoromethyl)pyrimidin-2-yl]piperidine-4-carboxylic acid

CAS: 832737-40-3

Versatile small molecule scaffold

Formula: C₁₂H₁₄F₃N₃O₂

Purity: Min. 95%

Molecular weight: 289.25 g/mol

Ref: 3D-HIB73740