CAS 832737-47-0
:5-(4-Chlorophenyl)-4,5,6,7-tetrahydro-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid hydrazide
Description:
5-(4-Chlorophenyl)-4,5,6,7-tetrahydro-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a trifluoromethyl group, which is known for its influence on the compound's lipophilicity and biological activity. The presence of a hydrazide functional group suggests potential reactivity, particularly in forming hydrazones or undergoing further derivatization. The chlorophenyl substituent may enhance the compound's pharmacological properties, potentially impacting its interaction with biological targets. This compound is likely to exhibit specific solubility characteristics, stability under various conditions, and may possess biological activity, making it of interest in medicinal chemistry. Its CAS number, 832737-47-0, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug discovery and development. Overall, the unique structural features of this compound suggest it may have significant implications in pharmaceutical research.
Formula:C14H13ClF3N5O
InChI:InChI=1S/C14H13ClF3N5O/c15-8-3-1-7(2-4-8)9-5-11(14(16,17)18)23-12(20-9)6-10(22-23)13(24)21-19/h1-4,6,9,11,20H,5,19H2,(H,21,24)
InChI key:InChIKey=MORLFGFQRGLQGE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1N2C(NC(C1)C3=CC=C(Cl)C=C3)=CC(C(NN)=O)=N2
Synonyms:- Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 5-(4-chlorophenyl)-4,5,6,7-tetrahydro-7-(trifluoromethyl)-, hydrazide
- 5-(4-Chlorophenyl)-4,5,6,7-tetrahydro-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.