CAS 832737-50-5

5-[(2-Chloro-5-methylphenoxy)methyl]-2-furancarboxylic acid hydrazide

Description:

5-[(2-Chloro-5-methylphenoxy)methyl]-2-furancarboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a furan ring, a hydrazide functional group, and a chlorinated aromatic moiety. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydrazide group. The chlorinated phenoxy group may impart specific biological activities or enhance solubility in organic solvents. The presence of the furan ring suggests potential applications in organic synthesis and medicinal chemistry, as furan derivatives are often explored for their pharmacological properties. Additionally, the compound's hydrazide functionality may allow for further derivatization, making it a versatile intermediate in chemical synthesis. Overall, this compound's characteristics make it of interest in various fields, including pharmaceuticals and agrochemicals, although specific biological activities and applications would require further investigation.

Formula: C₁₃H₁₃ClN₂O₃

InChI: InChI=1S/C13H13ClN2O3/c1-8-2-4-10(14)12(6-8)18-7-9-3-5-11(19-9)13(17)16-15/h2-6H,7,15H2,1H3,(H,16,17)

InChI key: InChIKey=AIYDQLIAGGOQCT-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)C=CC(C)=C1)C=2OC(C(NN)=O)=CC2

Synonyms:

• 5-[(2-Chloro-5-methylphenoxy)methyl]-2-furancarboxylic acid hydrazide
• 2-Furancarboxylic acid, 5-[(2-chloro-5-methylphenoxy)methyl]-, hydrazide