CymitQuimica logo

CAS 832737-52-7

:

6-(2,4-Difluorophenyl)-3-methyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine

Description:
6-(2,4-Difluorophenyl)-3-methyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine, with the CAS number 832737-52-7, is a heterocyclic compound featuring a triazole and thiadiazine structure. This compound is characterized by the presence of a difluorophenyl group, which contributes to its unique chemical properties and potential biological activity. The triazole ring is known for its stability and ability to participate in various chemical reactions, while the thiadiazine moiety can influence the compound's reactivity and interaction with biological targets. The presence of fluorine atoms typically enhances lipophilicity and can affect the compound's pharmacokinetic properties. This substance may exhibit interesting pharmacological activities, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and its potential applications could span various fields, including pharmaceuticals and agrochemicals. As with any chemical compound, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H8F2N4S
InChI:InChI=1S/C11H8F2N4S/c1-6-14-15-11-17(6)16-10(5-18-11)8-3-2-7(12)4-9(8)13/h2-4H,5H2,1H3
InChI key:InChIKey=OWSQWLCXCKHHCS-UHFFFAOYSA-N
SMILES:CC=1N2C(SCC(=N2)C3=C(F)C=C(F)C=C3)=NN1
Synonyms:
  • 7H-1,2,4-Triazolo[3,4-b][1,3,4]thiadiazine, 6-(2,4-difluorophenyl)-3-methyl-
  • 6-(2,4-Difluorophenyl)-3-methyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine
  • 6-(2,4-DIFLUORO-PHENYL)-3-METHYL-7 H-[1,2,4]TRIAZOLO[3,4-B ][1,3,4]THIADIAZINE
  • ART-CHEM-BB B014791
  • AKOS B014791
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.