CAS 832737-53-8

4-(1H-Tetrazol-1-yl)benzeneacetic acid hydrazide

Description:

4-(1H-Tetrazol-1-yl)benzeneacetic acid hydrazide is a chemical compound characterized by its unique structure, which includes a tetrazole ring and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and tetrazoles, such as potential biological activity and solubility in polar solvents. The presence of the tetrazole moiety may contribute to its ability to form hydrogen bonds and participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Additionally, the benzeneacetic acid component suggests potential applications in pharmaceuticals, particularly in the synthesis of compounds with anti-inflammatory or analgesic properties. The compound's hydrazide functionality may also enhance its reactivity, allowing for further derivatization. Overall, 4-(1H-Tetrazol-1-yl)benzeneacetic acid hydrazide is a versatile compound with potential applications in various fields, including organic synthesis and medicinal chemistry.

Formula: C₉H₁₀N₆O

InChI: InChI=1S/C9H10N6O/c10-12-9(16)5-7-1-3-8(4-2-7)15-6-11-13-14-15/h1-4,6H,5,10H2,(H,12,16)

InChI key: InChIKey=WDNMZSRTZZEGLS-UHFFFAOYSA-N

SMILES: C(C(NN)=O)C1=CC=C(C=C1)N2C=NN=N2

Synonyms:

• 4-(1H-Tetrazol-1-yl)benzeneacetic acid hydrazide
• Benzeneacetic acid, 4-(1H-tetrazol-1-yl)-, hydrazide

(4-Tetrazol-1-yl-phenyl)-acetic acid hydrazide

CAS: 832737-53-8

Versatile small molecule scaffold

Formula: C₉H₁₀N₆O

Purity: Min. 95%

Molecular weight: 218.22 g/mol

Ref: 3D-HIB73753