CAS 832737-56-1
:2-(Ethylsulfonyl)-4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidine
Description:
2-(Ethylsulfonyl)-4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidine is a synthetic organic compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an ethylsulfonyl group, which enhances its solubility and reactivity, and a trifluoromethyl group that contributes to its lipophilicity and potential biological activity. The presence of a 4-fluorophenyl substituent adds to its structural complexity and may influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the pyrimidine structure can lead to varied biological activities. The compound's unique functional groups suggest potential applications in drug development, particularly in targeting specific enzymes or receptors. As with many fluorinated compounds, it may exhibit enhanced metabolic stability and bioavailability. Safety and handling precautions should be observed due to the presence of fluorine and sulfonyl groups, which can affect toxicity and environmental impact.
Formula:C13H10F4N2O2S
InChI:InChI=1S/C13H10F4N2O2S/c1-2-22(20,21)12-18-10(7-11(19-12)13(15,16)17)8-3-5-9(14)6-4-8/h3-7H,2H2,1H3
InChI key:InChIKey=XAWXHKRISVXHLV-UHFFFAOYSA-N
SMILES:S(CC)(=O)(=O)C=1N=C(C=C(C(F)(F)F)N1)C2=CC=C(F)C=C2
Synonyms:- Pyrimidine, 2-(ethylsulfonyl)-4-(4-fluorophenyl)-6-(trifluoromethyl)-
- 2-(Ethylsulfonyl)-4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.